Products 2633633-39-1
CAS 2633633-39-1 is the registry number for E3 ligase Ligand 25. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,3,4,5,6-pentafluorophenyl) 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate (CAS 2633633-39-1) is a chemical compound with the molecular formula C17H8ClF5N2O4 and a molecular weight of 434.7 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate. InChIKey: ZOUXZDKKKNCUBA-UHFFFAOYSA-N.
| Molecular formula | C17H8ClF5N2O4 |
|---|---|
| Molecular weight | 434.7 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate |
| InChIKey | ZOUXZDKKKNCUBA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C(C=CC(=C2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
E3 ligase Ligand 25, orb2564499