CAS 263365-48-6 appears in our catalog under these names: 3-Bromo-6-chloro-7-methylchromone, 3-Bromo-6-chloro-7-methylchromone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2g, 5g, 10g, 100mg, 250mg.
3-bromo-6-chloro-7-methylchromen-4-one (CAS 263365-48-6) is a chemical compound with the molecular formula C10H6BrClO2 and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-6-chloro-7-methylchromen-4-one. InChIKey: BICIBGQLPWNJLT-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClO2 |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-6-chloro-7-methylchromen-4-one |
| InChIKey | BICIBGQLPWNJLT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=O)C(=CO2)Br |
Computed by PubChem (NCBI)