CAS 2633725-30-9 appears in our catalog under these names: 2-(4-Chloro-3-(2,4-dioxotetrahydropyrimidin-1(2H)-yl)phenoxy)acetic acid, 98%, Hydrouracil-(4-Chlorophenoxy)-O-C-COOH. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid (CAS 2633725-30-9) is a chemical compound with the molecular formula C12H11ClN2O5 and a molecular weight of 298.68 g/mol. IUPAC name: 2-[4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid. InChIKey: SLIBYTDTTFLVNY-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O5 |
|---|---|
| Molecular weight | 298.68 g/mol |
| IUPAC name | 2-[4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]acetic acid |
| InChIKey | SLIBYTDTTFLVNY-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C(C=CC(=C2)OCC(=O)O)Cl |
Computed by PubChem (NCBI)