CAS 263398-16-9 is the registry number for 4-(Adamantan-1-yl)phenyl trifluoromethanesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
[4-(1-adamantyl)phenyl] trifluoromethanesulfonate (CAS 263398-16-9) is a chemical compound with the molecular formula C17H19F3O3S and a molecular weight of 360.4 g/mol. IUPAC name: [4-(1-adamantyl)phenyl] trifluoromethanesulfonate. InChIKey: WFYDWLVJOHAMEA-UHFFFAOYSA-N.
| Molecular formula | C17H19F3O3S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | [4-(1-adamantyl)phenyl] trifluoromethanesulfonate |
| InChIKey | WFYDWLVJOHAMEA-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)