Products 263403-20-9
CAS 263403-20-9 appears in our catalog under these names: 2-((2,6-dichloropyrimidin-4-yl)(methyl)amino)acetic acid, 98%, 98%, N-(2,6-Dichloropyrimidin-4-yl)-N-methylglycine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-[(2,6-dichloropyrimidin-4-yl)-methylamino]acetic acid (CAS 263403-20-9) is a chemical compound with the molecular formula C7H7Cl2N3O2 and a molecular weight of 236.05 g/mol. IUPAC name: 2-[(2,6-dichloropyrimidin-4-yl)-methylamino]acetic acid. InChIKey: WADACDNNWJRYHG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3O2 |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | 2-[(2,6-dichloropyrimidin-4-yl)-methylamino]acetic acid |
| InChIKey | WADACDNNWJRYHG-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)