Products 2634356-52-6
CAS 2634356-52-6 is the registry number for VEGFR-2-IN-35. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-benzamido-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide (CAS 2634356-52-6) is a chemical compound with the molecular formula C25H19N3O3 and a molecular weight of 409.4 g/mol. IUPAC name: 4-benzamido-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide. InChIKey: YATPIUBYVUVDJI-WGOQTCKBSA-N.
| Molecular formula | C25H19N3O3 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | 4-benzamido-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide |
| InChIKey | YATPIUBYVUVDJI-WGOQTCKBSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C(=O)N/N=C/C3=CC4=CC=CC=C4C=C3O |
Computed by PubChem (NCBI)