Products 2478584-74-4
CAS 2478584-74-4 is the registry number for αβ-Tubulin-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[3-(1,3-benzodioxol-5-yloxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine (CAS 2478584-74-4) is a chemical compound with the molecular formula C25H19N3O3 and a molecular weight of 409.4 g/mol. IUPAC name: N-[[3-(1,3-benzodioxol-5-yloxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine. InChIKey: AGUNDEAVRTZOAH-UHFFFAOYSA-N.
| Molecular formula | C25H19N3O3 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | N-[[3-(1,3-benzodioxol-5-yloxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | AGUNDEAVRTZOAH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OC3=CC=CC(=C3)CNC4=NC=C5C(=C4)C6=CC=CC=C6N5 |
Computed by PubChem (NCBI)