Products 26346-39-4

CAS 26346-39-4 is the registry number for 7-Methyltryptamine hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 26346-39-4) is a chemical compound with the molecular formula C11H15ClN2 and a molecular weight of 210.70 g/mol. IUPAC name: 2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: XXXLVXQSFKCFAL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClN2
Molecular weight210.70 g/mol
IUPAC name2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride
InChIKeyXXXLVXQSFKCFAL-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)C(=CN2)CCN.Cl

Computed by PubChem (NCBI)