CAS 26346-39-4 is the registry number for 7-Methyltryptamine hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g, 50g, 100g.
2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 26346-39-4) is a chemical compound with the molecular formula C11H15ClN2 and a molecular weight of 210.70 g/mol. IUPAC name: 2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: XXXLVXQSFKCFAL-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2 |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 2-(7-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | XXXLVXQSFKCFAL-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)