CAS 2635394-10-2 is the registry number for Carba1, 98.23%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg.
6-chloro-1,4-dimethyl-3-pyrrol-1-yl-9H-carbazole (CAS 2635394-10-2) is a chemical compound with the molecular formula C18H15ClN2 and a molecular weight of 294.8 g/mol. IUPAC name: 6-chloro-1,4-dimethyl-3-pyrrol-1-yl-9H-carbazole. InChIKey: ACQHOGDRJNVGBV-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2 |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 6-chloro-1,4-dimethyl-3-pyrrol-1-yl-9H-carbazole |
| InChIKey | ACQHOGDRJNVGBV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC3=C2C=C(C=C3)Cl)C)N4C=CC=C4 |
Computed by PubChem (NCBI)