Products 2636-31-9
CAS 2636-31-9 is the registry number for Janus red. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]phenyl]-trimethylazanium chloride (CAS 2636-31-9) is a chemical compound with the molecular formula C26H26ClN5O and a molecular weight of 460.0 g/mol. IUPAC name: [3-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]phenyl]-trimethylazanium chloride. InChIKey: HGWOEPQHKBLMKW-UHFFFAOYSA-N.
| Molecular formula | C26H26ClN5O |
|---|---|
| Molecular weight | 460.0 g/mol |
| IUPAC name | [3-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]phenyl]-trimethylazanium chloride |
| InChIKey | HGWOEPQHKBLMKW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N=NC2=C(C=CC3=CC=CC=C32)O)N=NC4=CC(=CC=C4)[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)