Products 2636642-24-3

CAS 2636642-24-3 is the registry number for 4-Bromo-6-(trifluoromethyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-bromo-6-(trifluoromethyl)-1H-indole-2-carboxylic acid (CAS 2636642-24-3) is a chemical compound with the molecular formula C10H5BrF3NO2 and a molecular weight of 308.05 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)-1H-indole-2-carboxylic acid. InChIKey: QSXVQMOEVCZLOF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrF3NO2
Molecular weight308.05 g/mol
IUPAC name4-bromo-6-(trifluoromethyl)-1H-indole-2-carboxylic acid
InChIKeyQSXVQMOEVCZLOF-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1NC(=C2)C(=O)O)Br)C(F)(F)F

Computed by PubChem (NCBI)