CAS 2636798-54-2 is the registry number for Thalidomide-Pip-N-boc. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl N-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]carbamate (CAS 2636798-54-2) is a chemical compound with the molecular formula C23H28N4O6 and a molecular weight of 456.5 g/mol. IUPAC name: tert-butyl N-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]carbamate. InChIKey: DSOMULXPNDEPTK-UHFFFAOYSA-N.
| Molecular formula | C23H28N4O6 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | tert-butyl N-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]carbamate |
| InChIKey | DSOMULXPNDEPTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC1)C2=CC3=C(C=C2)C(=O)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)