Products 263717-32-4

CAS 263717-32-4 is the registry number for Estrogen receptor-agonist-1, 98.69%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol (CAS 263717-32-4) is a chemical compound with the molecular formula C24H22N2O2 and a molecular weight of 370.4 g/mol. IUPAC name: 4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol. InChIKey: RBPCYNVLBMIKAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H22N2O2
Molecular weight370.4 g/mol
IUPAC name4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol
InChIKeyRBPCYNVLBMIKAJ-UHFFFAOYSA-N
SMILESCCCC1=C(N(N=C1C2=CC=C(C=C2)O)C3=CC=CC=C3)C4=CC=C(C=C4)O

Computed by PubChem (NCBI)