CAS 263717-32-4 is the registry number for Estrogen receptor-agonist-1, 98.69%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol (CAS 263717-32-4) is a chemical compound with the molecular formula C24H22N2O2 and a molecular weight of 370.4 g/mol. IUPAC name: 4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol. InChIKey: RBPCYNVLBMIKAJ-UHFFFAOYSA-N.
| Molecular formula | C24H22N2O2 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 4-[3-(4-hydroxyphenyl)-1-phenyl-4-propylpyrazol-5-yl]phenol |
| InChIKey | RBPCYNVLBMIKAJ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N(N=C1C2=CC=C(C=C2)O)C3=CC=CC=C3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)