CAS 2637388-41-9 is the registry number for 5,6-Dichloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine (CAS 2637388-41-9) is a chemical compound with the molecular formula C7H3Cl2FN2 and a molecular weight of 205.01 g/mol. IUPAC name: 5,6-dichloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine. InChIKey: YFEDMDJJRNSGOA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FN2 |
|---|---|
| Molecular weight | 205.01 g/mol |
| IUPAC name | 5,6-dichloro-4-fluoro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | YFEDMDJJRNSGOA-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=C(C(=C21)F)Cl)Cl |
Computed by PubChem (NCBI)