CAS 26377-76-4 appears in our catalog under these names: (1H-Indol-3-ylsulfanyl)methanimidamide hydroiodide, 95%, 2-(1H-Indol-3-yl)isothiouronium iodide, 1H-indol-3-yl imidothiocarbamate hydroiodide, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 250mg.
1H-indol-3-yl carbamimidothioate;hydroiodide (CAS 26377-76-4) is a chemical compound with the molecular formula C9H10IN3S and a molecular weight of 319.17 g/mol. IUPAC name: 1H-indol-3-yl carbamimidothioate;hydroiodide. InChIKey: LQKOQCZXEQTTIW-UHFFFAOYSA-N.
| Molecular formula | C9H10IN3S |
|---|---|
| Molecular weight | 319.17 g/mol |
| IUPAC name | 1H-indol-3-yl carbamimidothioate;hydroiodide |
| InChIKey | LQKOQCZXEQTTIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)SC(=N)N.I |
Computed by PubChem (NCBI)