CAS 26378-71-2 is the registry number for 2-(2,4,6-Trichlorophenoxy)ethanamine hydrochloride, 97%. Offered by: Fluorochem. Available pack sizes: 250mg.
2-(2,4,6-trichlorophenoxy)ethanamine;hydrochloride (CAS 26378-71-2) is a chemical compound with the molecular formula C8H9Cl4NO and a molecular weight of 277.0 g/mol. IUPAC name: 2-(2,4,6-trichlorophenoxy)ethanamine;hydrochloride. InChIKey: NUCSWKPBJZYMQZ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl4NO |
|---|---|
| Molecular weight | 277.0 g/mol |
| IUPAC name | 2-(2,4,6-trichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | NUCSWKPBJZYMQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCCN)Cl)Cl.Cl |
Computed by PubChem (NCBI)