CAS 26378-73-4 appears in our catalog under these names: 2,4,6-Trichlorobenzene-1,3-diol, 95%, 2,4,6–trichlororesorcinol, 2,4,6-Trichlorobenzene-1,3-diol, 2,4,6-Trichlorobenzene-1,3-diol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
2,4,6-trichlorobenzene-1,3-diol (CAS 26378-73-4) is a chemical compound with the molecular formula C6H3Cl3O2 and a molecular weight of 213.4 g/mol. IUPAC name: 2,4,6-trichlorobenzene-1,3-diol. InChIKey: NHOATJNESSAPCQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2 |
|---|---|
| Molecular weight | 213.4 g/mol |
| IUPAC name | 2,4,6-trichlorobenzene-1,3-diol |
| InChIKey | NHOATJNESSAPCQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)O)Cl)O)Cl |
Computed by PubChem (NCBI)