CAS 26381-41-9 appears in our catalog under these names: Arianor Mahogany (Technical Grade), 8-((4-Aminophenyl)diazenyl)-7-hydroxy-N,N,N-trimethylnaphthalen-2-aminium chloride, 95%, Basic Brown 16, 95%, 95%. Offered by: TRC, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g.
[8-[(4-aminophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-trimethylazanium chloride (CAS 26381-41-9) is a chemical compound with the molecular formula C19H21ClN4O and a molecular weight of 356.8 g/mol. IUPAC name: [8-[(4-aminophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-trimethylazanium chloride. InChIKey: UXEAWNJALIUYRH-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN4O |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | [8-[(4-aminophenyl)diazenyl]-7-hydroxynaphthalen-2-yl]-trimethylazanium chloride |
| InChIKey | UXEAWNJALIUYRH-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C1=CC2=C(C=C1)C=CC(=C2N=NC3=CC=C(C=C3)N)O.[Cl-] |
Computed by PubChem (NCBI)