CAS 26381-66-8 is the registry number for Alprazolam Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-benzoyl-4-chlorophenyl)-2,2,2-trichloroacetamide (CAS 26381-66-8) is a chemical compound with the molecular formula C15H9Cl4NO2 and a molecular weight of 377.0 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2,2,2-trichloroacetamide. InChIKey: YDNQWVQHOZJNLQ-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl4NO2 |
|---|---|
| Molecular weight | 377.0 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-2,2,2-trichloroacetamide |
| InChIKey | YDNQWVQHOZJNLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)