CAS 2638466-09-6 is the registry number for (1S,3R)-3-(2-(Benzyloxy)ethyl)cyclopentan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,3R)-3-(2-phenylmethoxyethyl)cyclopentan-1-amine (CAS 2638466-09-6) is a chemical compound with the molecular formula C14H21NO and a molecular weight of 219.32 g/mol. IUPAC name: cis-(1S,3R)-3-(2-phenylmethoxyethyl)cyclopentan-1-amine. InChIKey: SCBWZOODCOZLKO-JSGCOSHPSA-N.
| Molecular formula | C14H21NO |
|---|---|
| Molecular weight | 219.32 g/mol |
| IUPAC name | cis-(1S,3R)-3-(2-phenylmethoxyethyl)cyclopentan-1-amine |
| InChIKey | SCBWZOODCOZLKO-JSGCOSHPSA-N |
| SMILES | C1C[C@@H](C[C@@H]1CCOCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)