Products 2638537-21-8
CAS 2638537-21-8 is the registry number for tert-Butyl 5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
Tert-butyl 5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 2638537-21-8) is a chemical compound with the molecular formula C20H25BN2O4 and a molecular weight of 368.2 g/mol. IUPAC name: tert-butyl 5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: LREGGPXGBYFJJY-UHFFFAOYSA-N.
| Molecular formula | C20H25BN2O4 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | tert-butyl 5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | LREGGPXGBYFJJY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C(=O)OC(C)(C)C)C=CC(=C3)C#N |
Computed by PubChem (NCBI)