CAS 2639220-83-8 is the registry number for (trans)-tert-butyl 3-bromo-4-(2-hydroxyethoxy) pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3S,4S)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate (CAS 2639220-83-8) is a chemical compound with the molecular formula C11H20BrNO4 and a molecular weight of 310.18 g/mol. IUPAC name: tert-butyl (3S,4S)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate. InChIKey: FJSGHPQXHOBEOW-IUCAKERBSA-N.
| Molecular formula | C11H20BrNO4 |
|---|---|
| Molecular weight | 310.18 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate |
| InChIKey | FJSGHPQXHOBEOW-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)Br)OCCO |
Computed by PubChem (NCBI)