CAS 2639324-77-7 is the registry number for Potassium (2-bromo-5-methoxyphenyl)trifluoroboranuide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Potassium (2-bromo-5-methoxyphenyl)-trifluoroboranuide (CAS 2639324-77-7) is a chemical compound with the molecular formula C7H6BBrF3KO and a molecular weight of 292.93 g/mol. IUPAC name: potassium (2-bromo-5-methoxyphenyl)-trifluoroboranuide. InChIKey: CYSHSDTYQDXAQN-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF3KO |
|---|---|
| Molecular weight | 292.93 g/mol |
| IUPAC name | potassium (2-bromo-5-methoxyphenyl)-trifluoroboranuide |
| InChIKey | CYSHSDTYQDXAQN-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC(=C1)OC)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)