Products 2639531-53-4
CAS 2639531-53-4 is the registry number for Antifungal agent 15. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-N'-(2,4-difluorophenyl)acetohydrazide (CAS 2639531-53-4) is a chemical compound with the molecular formula C19H11F8N3O2 and a molecular weight of 465.3 g/mol. IUPAC name: 2-[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-N'-(2,4-difluorophenyl)acetohydrazide. InChIKey: BKPXMGNLKGHCHK-UHFFFAOYSA-N.
| Molecular formula | C19H11F8N3O2 |
|---|---|
| Molecular weight | 465.3 g/mol |
| IUPAC name | 2-[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-N'-(2,4-difluorophenyl)acetohydrazide |
| InChIKey | BKPXMGNLKGHCHK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)N=C(C=C2OCC(=O)NNC3=C(C=C(C=C3)F)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 15, orb1690721