Products 2639625-50-4

CAS 2639625-50-4 is the registry number for 4-Fluoro-5-hydroxybenzene-1,2-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-5-hydroxyphthalic acid (CAS 2639625-50-4) is a chemical compound with the molecular formula C8H5FO5 and a molecular weight of 200.12 g/mol. IUPAC name: 4-fluoro-5-hydroxyphthalic acid. InChIKey: LUHDDCUZTFTVDV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5FO5
Molecular weight200.12 g/mol
IUPAC name4-fluoro-5-hydroxyphthalic acid
InChIKeyLUHDDCUZTFTVDV-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1O)F)C(=O)O)C(=O)O

Computed by PubChem (NCBI)