CAS 2639626-93-8 is the registry number for 1-Bromo-2-fluoro-3-(methoxy-d3)-5-methylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-bromo-2-fluoro-5-methyl-3-(trideuteriomethoxy)benzene (CAS 2639626-93-8) is a chemical compound with the molecular formula C8H8BrFO and a molecular weight of 222.07 g/mol. IUPAC name: 1-bromo-2-fluoro-5-methyl-3-(trideuteriomethoxy)benzene. InChIKey: MCZSSZCFZHOCTG-BMSJAHLVSA-N.
| Molecular formula | C8H8BrFO |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 1-bromo-2-fluoro-5-methyl-3-(trideuteriomethoxy)benzene |
| InChIKey | MCZSSZCFZHOCTG-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=CC(=C1)C)Br)F |
Computed by PubChem (NCBI)