Products 2639627-08-8
CAS 2639627-08-8 is the registry number for 2,2,2-Trifluoro-N-[2-(oxiran-2-yl)ethyl]-N-(2,2,2-trifluoroethyl)acetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,2-trifluoro-N-[2-(oxiran-2-yl)ethyl]-N-(2,2,2-trifluoroethyl)acetamide (CAS 2639627-08-8) is a chemical compound with the molecular formula C8H9F6NO2 and a molecular weight of 265.15 g/mol. IUPAC name: 2,2,2-trifluoro-N-[2-(oxiran-2-yl)ethyl]-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: XLPDPPCIDTVRGG-UHFFFAOYSA-N.
| Molecular formula | C8H9F6NO2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[2-(oxiran-2-yl)ethyl]-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | XLPDPPCIDTVRGG-UHFFFAOYSA-N |
| SMILES | C1C(O1)CCN(CC(F)(F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)