Products 2639627-18-0
CAS 2639627-18-0 is the registry number for 4-Bromo-3,5-dichlorophenyl methanesulfonate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-bromo-3,5-dichlorophenyl) methanesulfonate (CAS 2639627-18-0) is a chemical compound with the molecular formula C7H5BrCl2O3S and a molecular weight of 319.99 g/mol. IUPAC name: (4-bromo-3,5-dichlorophenyl) methanesulfonate. InChIKey: XDOGETNBWUBABA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O3S |
|---|---|
| Molecular weight | 319.99 g/mol |
| IUPAC name | (4-bromo-3,5-dichlorophenyl) methanesulfonate |
| InChIKey | XDOGETNBWUBABA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC(=C(C(=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)