CAS 2640039-55-8 is the registry number for (3R,4S)-3-Methyl-1-(methylsulfonyl)piperidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-amine (CAS 2640039-55-8) is a chemical compound with the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. IUPAC name: (3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-amine. InChIKey: FRNHPJXWQSBQMR-RQJHMYQMSA-N.
| Molecular formula | C7H16N2O2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | (3R,4S)-3-methyl-1-methylsulfonylpiperidin-4-amine |
| InChIKey | FRNHPJXWQSBQMR-RQJHMYQMSA-N |
| SMILES | C[C@@H]1CN(CC[C@@H]1N)S(=O)(=O)C |
Computed by PubChem (NCBI)