CAS 26401-27-4 appears in our catalog under these names: Phosphorous acid,isooctyl diphenyl ester, 98% +(four isomers mixture), 98% +(four isomers mixture), Phosphorous acid, isooctyl diphenyl ester, 98% +(four isomers mixture), Diphenyl isooctyl phosphite, 98% +(four isomers mixture). Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 500g.
6-methylheptyl diphenyl phosphite (CAS 26401-27-4) is a chemical compound with the molecular formula C20H27O3P and a molecular weight of 346.4 g/mol. IUPAC name: 6-methylheptyl diphenyl phosphite. InChIKey: YEQHNTCMAVPEKP-UHFFFAOYSA-N.
| Molecular formula | C20H27O3P |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 6-methylheptyl diphenyl phosphite |
| InChIKey | YEQHNTCMAVPEKP-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCOP(OC1=CC=CC=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)