Products 2640149-52-4
CAS 2640149-52-4 is the registry number for Vezf1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(3-chloro-4-methyl-5-sulfobenzoyl)amino]-2-hydroxynaphthalene-1-carboxylic acid (CAS 2640149-52-4) is a chemical compound with the molecular formula C19H14ClNO7S and a molecular weight of 435.8 g/mol. IUPAC name: 6-[(3-chloro-4-methyl-5-sulfobenzoyl)amino]-2-hydroxynaphthalene-1-carboxylic acid. InChIKey: XOOUGZYQEAKKMZ-UHFFFAOYSA-N.
| Molecular formula | C19H14ClNO7S |
|---|---|
| Molecular weight | 435.8 g/mol |
| IUPAC name | 6-[(3-chloro-4-methyl-5-sulfobenzoyl)amino]-2-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | XOOUGZYQEAKKMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)C(=O)NC2=CC3=C(C=C2)C(=C(C=C3)O)C(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)