Products 2640653-91-2
CAS 2640653-91-2 is the registry number for Angexostat. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-cyano-6,6-difluoro-5,7-dihydro-4H-2-benzothiophen-1-yl)-2-hydroxybenzoic acid (CAS 2640653-91-2) is a chemical compound with the molecular formula C16H11F2NO3S and a molecular weight of 335.3 g/mol. IUPAC name: 4-(3-cyano-6,6-difluoro-5,7-dihydro-4H-2-benzothiophen-1-yl)-2-hydroxybenzoic acid. InChIKey: UTTXOYFICPSQLS-UHFFFAOYSA-N.
| Molecular formula | C16H11F2NO3S |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | 4-(3-cyano-6,6-difluoro-5,7-dihydro-4H-2-benzothiophen-1-yl)-2-hydroxybenzoic acid |
| InChIKey | UTTXOYFICPSQLS-UHFFFAOYSA-N |
| SMILES | C1CC(CC2=C(SC(=C21)C#N)C3=CC(=C(C=C3)C(=O)O)O)(F)F |
Computed by PubChem (NCBI)