Products 2640680-83-5
CAS 2640680-83-5 appears in our catalog under these names: 1–(4–Trifluoromethylphenyl)piperazine (hydrochloride), 1-(4-Trifluoromethylphenyl)piperazine (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
1-[4-(trifluoromethyl)phenyl]piperazine;dihydrochloride (CAS 2640680-83-5) is a chemical compound with the molecular formula C11H15Cl2F3N2 and a molecular weight of 303.15 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]piperazine;dihydrochloride. InChIKey: KCTSMDCJIMGOCL-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2F3N2 |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]piperazine;dihydrochloride |
| InChIKey | KCTSMDCJIMGOCL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)