CAS 2640813-40-5 is the registry number for 2,2′,3,3′,5,5′,6,6′-Octafluoro[1,1′-biphenyl]-4,4′-dicarboxaldehyde, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-formylphenyl)benzaldehyde (CAS 2640813-40-5) is a chemical compound with the molecular formula C14H2F8O2 and a molecular weight of 354.15 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-formylphenyl)benzaldehyde. InChIKey: LUGCYWBWLUYMDF-UHFFFAOYSA-N.
| Molecular formula | C14H2F8O2 |
|---|---|
| Molecular weight | 354.15 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-formylphenyl)benzaldehyde |
| InChIKey | LUGCYWBWLUYMDF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(=C(C(=C1F)F)C2=C(C(=C(C(=C2F)F)C=O)F)F)F)F |
Computed by PubChem (NCBI)