CAS 2641029-94-7 is the registry number for 4-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethoxy]-2-(1-methylethyl)-3-pyridinamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-ylpyridin-3-amine (CAS 2641029-94-7) is a chemical compound with the molecular formula C16H30N2O2Si and a molecular weight of 310.51 g/mol. IUPAC name: 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-ylpyridin-3-amine. InChIKey: YZUCDJXZSAXZDI-UHFFFAOYSA-N.
| Molecular formula | C16H30N2O2Si |
|---|---|
| Molecular weight | 310.51 g/mol |
| IUPAC name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-ylpyridin-3-amine |
| InChIKey | YZUCDJXZSAXZDI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=CC(=C1N)OCCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)