CAS 2641216-97-7 is the registry number for Potassium trifluoro(2-hydroxy-6-(trifluoromethyl)phenyl)borate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[2-hydroxy-6-(trifluoromethyl)phenyl]boranuide (CAS 2641216-97-7) is a chemical compound with the molecular formula C7H4BF6KO and a molecular weight of 268.01 g/mol. IUPAC name: potassium trifluoro-[2-hydroxy-6-(trifluoromethyl)phenyl]boranuide. InChIKey: WPLRNWILOXBKBN-UHFFFAOYSA-N.
| Molecular formula | C7H4BF6KO |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | potassium trifluoro-[2-hydroxy-6-(trifluoromethyl)phenyl]boranuide |
| InChIKey | WPLRNWILOXBKBN-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC=C1O)C(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)