CAS 2641239-09-8 is the registry number for Potassium trifluoro[4-(4-methoxyphenyl)phenyl]boranuide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Potassium trifluoro-[4-(4-methoxyphenyl)phenyl]boranuide (CAS 2641239-09-8) is a chemical compound with the molecular formula C13H11BF3KO and a molecular weight of 290.13 g/mol. IUPAC name: potassium trifluoro-[4-(4-methoxyphenyl)phenyl]boranuide. InChIKey: WMWCJVZEGMZXJF-UHFFFAOYSA-N.
| Molecular formula | C13H11BF3KO |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | potassium trifluoro-[4-(4-methoxyphenyl)phenyl]boranuide |
| InChIKey | WMWCJVZEGMZXJF-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)C2=CC=C(C=C2)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)