Products 2641398-04-9
CAS 2641398-04-9 appears in our catalog under these names: MrgprX2 antagonist–4, MrgprX2 antagonist-4 98%, MrgprX2 antagonist-4, 99.85%. Offered by: GLPBio, Ambeed, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 50 mg, 10 mg.
3-ethyl-7-methyl-2-propan-2-yl-1H-pyrimido[1,2-a]benzimidazol-4-one (CAS 2641398-04-9) is a chemical compound with the molecular formula C16H19N3O and a molecular weight of 269.34 g/mol. IUPAC name: 3-ethyl-7-methyl-2-propan-2-yl-1H-pyrimido[1,2-a]benzimidazol-4-one. InChIKey: GEBQJASGYKVDHG-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 3-ethyl-7-methyl-2-propan-2-yl-1H-pyrimido[1,2-a]benzimidazol-4-one |
| InChIKey | GEBQJASGYKVDHG-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC2=NC3=C(N2C1=O)C=C(C=C3)C)C(C)C |
Computed by PubChem (NCBI)