CAS 264144-59-4 appears in our catalog under these names: Cis-stilbeneboronic acid pinacol ester, 95%, cis–Stilbeneboronic acid pinacol ester, cis-Stilbeneboronic acid pinacol ester, 95% mix TBC as stabilizer, 95% mix TBC as stabilizer, (Z)-2-(1,2-Diphenylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% mix TBC as stabilizer. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 264144-59-4) is a chemical compound with the molecular formula C20H23BO2 and a molecular weight of 306.2 g/mol. IUPAC name: 2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HGZKORGQZNCVQC-OBGWFSINSA-N.
| Molecular formula | C20H23BO2 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HGZKORGQZNCVQC-OBGWFSINSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/C2=CC=CC=C2)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)