CAS 2641795-78-8 is the registry number for (8-Bromoindolizin-3-Yl)(3,4,5-Trifluorophenyl)Methanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(8-bromoindolizin-3-yl)-(3,4,5-trifluorophenyl)methanone (CAS 2641795-78-8) is a chemical compound with the molecular formula C15H7BrF3NO and a molecular weight of 354.12 g/mol. IUPAC name: (8-bromoindolizin-3-yl)-(3,4,5-trifluorophenyl)methanone. InChIKey: LJMHOWNTGKDFSR-UHFFFAOYSA-N.
| Molecular formula | C15H7BrF3NO |
|---|---|
| Molecular weight | 354.12 g/mol |
| IUPAC name | (8-bromoindolizin-3-yl)-(3,4,5-trifluorophenyl)methanone |
| InChIKey | LJMHOWNTGKDFSR-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CC=C2C(=O)C3=CC(=C(C(=C3)F)F)F)C(=C1)Br |
Computed by PubChem (NCBI)