CAS 2641804-57-9 is the registry number for Phenyl-[4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyrazol-1-yl]-acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate (CAS 2641804-57-9) is a chemical compound with the molecular formula C18H23BN2O4 and a molecular weight of 342.2 g/mol. IUPAC name: methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate. InChIKey: NDMLOSSIMKKLEM-UHFFFAOYSA-N.
| Molecular formula | C18H23BN2O4 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate |
| InChIKey | NDMLOSSIMKKLEM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)