CAS 1404431-51-1 is the registry number for 3-[4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyrazol-1-ylmethyl]-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzoate (CAS 1404431-51-1) is a chemical compound with the molecular formula C18H23BN2O4 and a molecular weight of 342.2 g/mol. IUPAC name: methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzoate. InChIKey: NWOWCCRETBLEPW-UHFFFAOYSA-N.
| Molecular formula | C18H23BN2O4 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzoate |
| InChIKey | NWOWCCRETBLEPW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CC(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)