CAS 2641824-49-7 is the registry number for Sodium 4-(dimethylamino)-4-methylpent-2-ynoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 4-(dimethylamino)-4-methylpent-2-ynoate (CAS 2641824-49-7) is a chemical compound with the molecular formula C8H12NNaO2 and a molecular weight of 177.18 g/mol. IUPAC name: sodium 4-(dimethylamino)-4-methylpent-2-ynoate. InChIKey: OMZUAQRNDXOZNS-UHFFFAOYSA-M.
| Molecular formula | C8H12NNaO2 |
|---|---|
| Molecular weight | 177.18 g/mol |
| IUPAC name | sodium 4-(dimethylamino)-4-methylpent-2-ynoate |
| InChIKey | OMZUAQRNDXOZNS-UHFFFAOYSA-M |
| SMILES | CC(C)(C#CC(=O)[O-])N(C)C.[Na+] |
Computed by PubChem (NCBI)