Products 2641825-05-8
CAS 2641825-05-8 is the registry number for Ethyl (2S,3R)-3-cyclopropylaziridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3R)-3-cyclopropylaziridine-2-carboxylate (CAS 2641825-05-8) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: ethyl (2S,3R)-3-cyclopropylaziridine-2-carboxylate. InChIKey: RMNWDHXAGPTQAN-RQJHMYQMSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | ethyl (2S,3R)-3-cyclopropylaziridine-2-carboxylate |
| InChIKey | RMNWDHXAGPTQAN-RQJHMYQMSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](N1)C2CC2 |
Computed by PubChem (NCBI)