CAS 2641825-22-9 is the registry number for tert-Butyl (S)-2-amino-3-(5-bromooxazol-2-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-amino-3-(5-bromo-1,3-oxazol-2-yl)propanoate (CAS 2641825-22-9) is a chemical compound with the molecular formula C10H15BrN2O3 and a molecular weight of 291.14 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(5-bromo-1,3-oxazol-2-yl)propanoate. InChIKey: YWDFDVHPYUUYIU-LURJTMIESA-N.
| Molecular formula | C10H15BrN2O3 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(5-bromo-1,3-oxazol-2-yl)propanoate |
| InChIKey | YWDFDVHPYUUYIU-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=NC=C(O1)Br)N |
Computed by PubChem (NCBI)