CAS 2641825-36-5 is the registry number for (S)-2-Amino-3-(2-bromooxazol-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(2-bromo-1,3-oxazol-4-yl)propanoic acid (CAS 2641825-36-5) is a chemical compound with the molecular formula C6H7BrN2O3 and a molecular weight of 235.04 g/mol. IUPAC name: (2S)-2-amino-3-(2-bromo-1,3-oxazol-4-yl)propanoic acid. InChIKey: MYRNORWJZWYDSC-BYPYZUCNSA-N.
| Molecular formula | C6H7BrN2O3 |
|---|---|
| Molecular weight | 235.04 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-bromo-1,3-oxazol-4-yl)propanoic acid |
| InChIKey | MYRNORWJZWYDSC-BYPYZUCNSA-N |
| SMILES | C1=C(N=C(O1)Br)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)