CAS 2641906-00-3 is the registry number for 6-Bromo-4-chloro-2,8-dimethylpyrido[2,3-d]pyrimidin-7(8H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-chloro-2,8-dimethylpyrido[2,3-d]pyrimidin-7-one (CAS 2641906-00-3) is a chemical compound with the molecular formula C9H7BrClN3O and a molecular weight of 288.53 g/mol. IUPAC name: 6-bromo-4-chloro-2,8-dimethylpyrido[2,3-d]pyrimidin-7-one. InChIKey: HSXISZAGRILZEJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClN3O |
|---|---|
| Molecular weight | 288.53 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,8-dimethylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | HSXISZAGRILZEJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C(=O)N2C)Br)C(=N1)Cl |
Computed by PubChem (NCBI)