CAS 2641907-09-5 is the registry number for (S)-2-(2-(1-Aminoethyl)-6-(difluoromethyl)phenyl)acetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[(1S)-1-aminoethyl]-6-(difluoromethyl)phenyl]acetonitrile (CAS 2641907-09-5) is a chemical compound with the molecular formula C11H12F2N2 and a molecular weight of 210.22 g/mol. IUPAC name: 2-[2-[(1S)-1-aminoethyl]-6-(difluoromethyl)phenyl]acetonitrile. InChIKey: HNIUJYIITVBIOZ-ZETCQYMHSA-N.
| Molecular formula | C11H12F2N2 |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 2-[2-[(1S)-1-aminoethyl]-6-(difluoromethyl)phenyl]acetonitrile |
| InChIKey | HNIUJYIITVBIOZ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)C(F)F)CC#N)N |
Computed by PubChem (NCBI)