CAS 2641915-74-2 is the registry number for 2-Amino-3-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2-amino-3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid;hydrochloride (CAS 2641915-74-2) is a chemical compound with the molecular formula C10H10ClF2NO4 and a molecular weight of 281.64 g/mol. IUPAC name: 2-amino-3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid;hydrochloride. InChIKey: SEOFBDFPMWILKV-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NO4 |
|---|---|
| Molecular weight | 281.64 g/mol |
| IUPAC name | 2-amino-3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid;hydrochloride |
| InChIKey | SEOFBDFPMWILKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(C(=O)O)N)OC(O2)(F)F.Cl |
Computed by PubChem (NCBI)