CAS 2642346-30-1 appears in our catalog under these names: MrgprX2 antagonist–2, MrgprX2 antagonist-2, 99.20%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 50 mg, 10 mg, 10mM/1mL, 25 mg.
3-[4-(3,5-difluorophenoxy)-2-pyridinyl]-1-ethyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]urea (CAS 2642346-30-1) is a chemical compound with the molecular formula C17H16F5N3O3 and a molecular weight of 405.32 g/mol. IUPAC name: 3-[4-(3,5-difluorophenoxy)-2-pyridinyl]-1-ethyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]urea. InChIKey: LLDJFKRONQQBRH-CQSZACIVSA-N.
| Molecular formula | C17H16F5N3O3 |
|---|---|
| Molecular weight | 405.32 g/mol |
| IUPAC name | 3-[4-(3,5-difluorophenoxy)-2-pyridinyl]-1-ethyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]urea |
| InChIKey | LLDJFKRONQQBRH-CQSZACIVSA-N |
| SMILES | CCN(C[C@H](C(F)(F)F)O)C(=O)NC1=NC=CC(=C1)OC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)